About 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine
2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine (PubChem CID 134386201) has the molecular formula C12H16FNO
and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine |
| PubChem CID | 134386201 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine |
| SMILES | COC1=C(C2CCCN2)C=C(F)CC=C1 |
| InChI | InChI=1S/C12H16FNO/c1-15-12-6-2-4-9(13)8-10(12)11-5-3-7-14-11/h2,6,8,11,14H,3-5,7H2,1H3 |
| InChIKey | ODUBINPECKQCFB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine?
The IUPAC name of 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine (CID 134386201) is 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine.
What is the SMILES notation for 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine?
The canonical SMILES for 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine is COC1=C(C2CCCN2)C=C(F)CC=C1.
What is the InChIKey of 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine?
The InChIKey is ODUBINPECKQCFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO/c1-15-12-6-2-4-9(13)8-10(12)11-5-3-7-14-11/h2,6,8,11,14H,3-5,7H2,1H3.
What are the key properties of 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine?
2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine has a molecular weight of 209.26 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2-methoxycyclohepta-1,3,6-trien-1-yl)pyrrolidine is sourced from PubChem (CID 134386201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).