About N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine
N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine (PubChem CID 134386213) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine.
Molecular Properties
| Compound Name | N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine |
| PubChem CID | 134386213 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine |
| SMILES | CCCCN(CC)C1=CC=NCN1 |
| InChI | InChI=1S/C10H19N3/c1-3-5-8-13(4-2)10-6-7-11-9-12-10/h6-7,12H,3-5,8-9H2,1-2H3 |
| InChIKey | FAWBIQUFPFXZTP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine?
The IUPAC name of N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine (CID 134386213) is N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine.
What is the SMILES notation for N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine?
The canonical SMILES for N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine is CCCCN(CC)C1=CC=NCN1.
What is the InChIKey of N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine?
The InChIKey is FAWBIQUFPFXZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-3-5-8-13(4-2)10-6-7-11-9-12-10/h6-7,12H,3-5,8-9H2,1-2H3.
What are the key properties of N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine?
N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine has a molecular weight of 181.28 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-ethyl-1,2-dihydropyrimidin-6-amine is sourced from PubChem (CID 134386213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).