C20H27N3O8S — CID 134386360
2,2-dioxo-5-[[(7R,10R)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-yl]methoxy]-1H-2λ6,1,3-benzothiadiazin-4-amine (PubChem CID 134386360) has the molecular formula C20H27N3O8S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2,2-dioxo-5-[[(7R,10R)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-yl]methoxy]-1H-2λ6,1,3-benzothiadiazin-4-amine.
| Compound Name | 2,2-dioxo-5-[[(7R,10R)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-yl]methoxy]-1H-2λ6,1,3-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 134386360 |
| Molecular Formula | C20H27N3O8S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2,2-dioxo-5-[[(7R,10R)-5,5,12,12-tetramethyl-4,6,8,11,13-pentaoxatricyclo[8.3.0.03,7]tridecan-9-yl]methoxy]-1H-2λ6,1,3-benzothiadiazin-4-amine |
| SMILES | CC1(C)OC2CC3OC(C)(C)O[C@H]3C(COc3cccc4c3C(N)=NS(=O)(=O)N4)O[C@@H]2O1 |
| InChI | InChI=1S/C20H27N3O8S/c1-19(2)28-12-8-13-18(31-20(3,4)29-13)27-14(16(12)30-19)9-26-11-7-5-6-10-15(11)17(21)23-32(24,25)22-10/h5-7,12-14,16,18,22H,8-9H2,1-4H3,(H2,21,23)/t12?,13?,14?,16-,18-/m1/s1 |
| InChIKey | RQGUFUXXSVDRPP-QDLPQEJSSA-N |
| XLogP | 1.23 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |