C62H50N6+2 — CID 134386484
5,7,20,22-tetrakis[(E)-2-(1H-indol-2-yl)ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaene (PubChem CID 134386484) has the molecular formula C62H50N6+2 and a molecular weight of 879.12 g/mol. Its IUPAC name is 5,7,20,22-tetrakis[(E)-2-(1H-indol-2-yl)ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaene.
| Compound Name | 5,7,20,22-tetrakis[(E)-2-(1H-indol-2-yl)ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaene |
|---|---|
| PubChem CID | 134386484 |
| Molecular Formula | C62H50N6+2 |
| Molecular Weight | 879.12 g/mol |
| Exact Mass | 878.41 |
| IUPAC Name | 5,7,20,22-tetrakis[(E)-2-(1H-indol-2-yl)ethenyl]-8,19-diazoniapentacyclo[13.9.0.02,12.03,8.019,24]tetracosa-1(15),2(12),3,5,7,13,19,21,23-nonaene |
| SMILES | C(=C/c1cc2ccccc2[nH]1)\c1cc(/C=C/c2cc3ccccc3[nH]2)[n+]2c(c1)-c1c(ccc3c1-c1cc(/C=C/c4cc5ccccc5[nH]4)cc(/C=C/c4cc5ccccc5[nH]4)[n+]1CCC3)CCC2 |
| InChI | InChI=1S/C62H48N6/c1-5-17-55-45(11-1)37-49(63-55)25-21-41-33-53(29-27-51-39-47-13-3-7-19-57(47)65-51)67-31-9-15-43-23-24-44-16-10-32-68-54(30-28-52-40-48-14-4-8-20-58(48)66-52)34-42(36-60(68)62(44)61(43)59(67)35-41)22-26-50-38-46-12-2-6-18-56(46)64-50/h1-8,11-14,17-30,33-40H,9-10,15-16,31-32H2,(H2,63,64,65,66)/p+2 |
| InChIKey | PPZRJFBKTJPDRH-UHFFFAOYSA-P |
| XLogP | 14.09 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.12 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|