About 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine
1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine (PubChem CID 134386603) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine |
| PubChem CID | 134386603 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine |
| SMILES | CC(N)CCCNC1=NCCN1 |
| InChI | InChI=1S/C8H18N4/c1-7(9)3-2-4-10-8-11-5-6-12-8/h7H,2-6,9H2,1H3,(H2,10,11,12) |
| InChIKey | ZKGSSJJUUCLALP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine?
The IUPAC name of 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine (CID 134386603) is 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine.
What is the SMILES notation for 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine?
The canonical SMILES for 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine is CC(N)CCCNC1=NCCN1.
What is the InChIKey of 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine?
The InChIKey is ZKGSSJJUUCLALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-7(9)3-2-4-10-8-11-5-6-12-8/h7H,2-6,9H2,1H3,(H2,10,11,12).
What are the key properties of 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine?
1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine has a molecular weight of 170.26 g/mol, XLogP of -0.34, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(4,5-dihydro-1H-imidazol-2-yl)pentane-1,4-diamine is sourced from PubChem (CID 134386603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).