About 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone
1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone (PubChem CID 134386633) has the molecular formula C8H13F2NO3
and a molecular weight of 209.19 g/mol. Its IUPAC name is 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone |
| PubChem CID | 134386633 |
| Molecular Formula | C8H13F2NO3 |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C(F)F)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C8H13F2NO3/c1-4(12)11-2-5(8(9)10)7(14)6(13)3-11/h5-8,13-14H,2-3H2,1H3/t5?,6-,7-/m1/s1 |
| InChIKey | WXNCUYORPMNHPI-JXBXZBNISA-N |
| XLogP | -0.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone?
The IUPAC name of 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone (CID 134386633) is 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone.
What is the SMILES notation for 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone?
The canonical SMILES for 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone is CC(=O)N1CC(C(F)F)[C@@H](O)[C@H](O)C1.
What is the InChIKey of 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone?
The InChIKey is WXNCUYORPMNHPI-JXBXZBNISA-N. The full InChI is InChI=1S/C8H13F2NO3/c1-4(12)11-2-5(8(9)10)7(14)6(13)3-11/h5-8,13-14H,2-3H2,1H3/t5?,6-,7-/m1/s1.
What are the key properties of 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone?
1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone has a molecular weight of 209.19 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidin-1-yl]ethanone is sourced from PubChem (CID 134386633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).