About (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol
(3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol (PubChem CID 134386645) has the molecular formula C7H13F2NO4S
and a molecular weight of 245.25 g/mol. Its IUPAC name is (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol.
Molecular Properties
| Compound Name | (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol |
| PubChem CID | 134386645 |
| Molecular Formula | C7H13F2NO4S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol |
| SMILES | CS(=O)(=O)N1CC(C(F)F)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H13F2NO4S/c1-15(13,14)10-2-4(7(8)9)6(12)5(11)3-10/h4-7,11-12H,2-3H2,1H3/t4?,5-,6-/m1/s1 |
| InChIKey | AVCABTLYFCCNDB-YSLANXFLSA-N |
| XLogP | -1.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol?
The IUPAC name of (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol (CID 134386645) is (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol.
What is the SMILES notation for (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol?
The canonical SMILES for (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol is CS(=O)(=O)N1CC(C(F)F)[C@@H](O)[C@H](O)C1.
What is the InChIKey of (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol?
The InChIKey is AVCABTLYFCCNDB-YSLANXFLSA-N. The full InChI is InChI=1S/C7H13F2NO4S/c1-15(13,14)10-2-4(7(8)9)6(12)5(11)3-10/h4-7,11-12H,2-3H2,1H3/t4?,5-,6-/m1/s1.
What are the key properties of (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol?
(3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol has a molecular weight of 245.25 g/mol, XLogP of -1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol is sourced from PubChem (CID 134386645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).