C11H20F2N2O3 — CID 134386672
(4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carboxamide (PubChem CID 134386672) has the molecular formula C11H20F2N2O3 and a molecular weight of 266.29 g/mol. Its IUPAC name is (4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carboxamide.
| Compound Name | (4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134386672 |
| Molecular Formula | C11H20F2N2O3 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (4R,5R)-N-butyl-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CC(C(F)F)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C11H20F2N2O3/c1-2-3-4-14-11(18)15-5-7(10(12)13)9(17)8(16)6-15/h7-10,16-17H,2-6H2,1H3,(H,14,18)/t7?,8-,9-/m1/s1 |
| InChIKey | YBUDTNMIGIZUCI-CFCGPWAMSA-N |
| XLogP | 0.41 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|