C11H14FNO2S — CID 134386684
(3R,4S,5S)-5-(4-fluorophenyl)sulfanylpiperidine-3,4-diol (PubChem CID 134386684) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is (3R,4S,5S)-5-(4-fluorophenyl)sulfanylpiperidine-3,4-diol.
| Compound Name | (3R,4S,5S)-5-(4-fluorophenyl)sulfanylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 134386684 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3R,4S,5S)-5-(4-fluorophenyl)sulfanylpiperidine-3,4-diol |
| SMILES | O[C@H]1[C@H](O)CNC[C@@H]1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2S/c12-7-1-3-8(4-2-7)16-10-6-13-5-9(14)11(10)15/h1-4,9-11,13-15H,5-6H2/t9-,10+,11+/m1/s1 |
| InChIKey | HWEAWIUAJCSSMG-VWYCJHECSA-N |
| XLogP | 0.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |