About 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine
7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 134387506) has the molecular formula C22H12N2OS
and a molecular weight of 352.42 g/mol. Its IUPAC name is 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine |
| PubChem CID | 134387506 |
| Molecular Formula | C22H12N2OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | c1ccc2c(c1)sc1nc(-c3ccc4c(c3)oc3ncccc34)ccc12 |
| InChI | InChI=1S/C22H12N2OS/c1-2-6-20-15(4-1)17-9-10-18(24-22(17)26-20)13-7-8-14-16-5-3-11-23-21(16)25-19(14)12-13/h1-12H |
| InChIKey | QYTYVPAXWDCAKV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine?
The IUPAC name of 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine (CID 134387506) is 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine.
What is the SMILES notation for 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine?
The canonical SMILES for 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine is c1ccc2c(c1)sc1nc(-c3ccc4c(c3)oc3ncccc34)ccc12.
What is the InChIKey of 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine?
The InChIKey is QYTYVPAXWDCAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N2OS/c1-2-6-20-15(4-1)17-9-10-18(24-22(17)26-20)13-7-8-14-16-5-3-11-23-21(16)25-19(14)12-13/h1-12H.
What are the key properties of 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine?
7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine has a molecular weight of 352.42 g/mol, XLogP of 6.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-([1]benzothiolo[2,3-b]pyridin-2-yl)-[1]benzofuro[2,3-b]pyridine is sourced from PubChem (CID 134387506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).