C21H24FN7O2S — CID 134387656
[[5-[(2S,5R,6S)-5-amino-6-fluorooxepan-2-yl]-1-methylpyrazol-4-yl]amino]-(2-indazol-1-yl-1,3-thiazol-4-yl)methanol (PubChem CID 134387656) has the molecular formula C21H24FN7O2S and a molecular weight of 457.54 g/mol. Its IUPAC name is [[5-[(2S,5R,6S)-5-amino-6-fluorooxepan-2-yl]-1-methylpyrazol-4-yl]amino]-(2-indazol-1-yl-1,3-thiazol-4-yl)methanol.
| Compound Name | [[5-[(2S,5R,6S)-5-amino-6-fluorooxepan-2-yl]-1-methylpyrazol-4-yl]amino]-(2-indazol-1-yl-1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 134387656 |
| Molecular Formula | C21H24FN7O2S |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | [[5-[(2S,5R,6S)-5-amino-6-fluorooxepan-2-yl]-1-methylpyrazol-4-yl]amino]-(2-indazol-1-yl-1,3-thiazol-4-yl)methanol |
| SMILES | Cn1ncc(NC(O)c2csc(-n3ncc4ccccc43)n2)c1[C@@H]1CC[C@@H](N)[C@H](F)CO1 |
| InChI | InChI=1S/C21H24FN7O2S/c1-28-19(18-7-6-14(23)13(22)10-31-18)15(9-24-28)26-20(30)16-11-32-21(27-16)29-17-5-3-2-4-12(17)8-25-29/h2-5,8-9,11,13-14,18,20,26,30H,6-7,10,23H2,1H3/t13-,14-,18+,20?/m1/s1 |
| InChIKey | GGVDNDXSFWTMNA-XTZRUQCWSA-N |
| XLogP | 2.84 |
| TPSA | 116.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|