C11H12N4O — CID 134387946
2-(methylamino)-5-(1H-pyrazol-4-yl)benzamide (PubChem CID 134387946) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(methylamino)-5-(1H-pyrazol-4-yl)benzamide.
| Compound Name | 2-(methylamino)-5-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 134387946 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-(methylamino)-5-(1H-pyrazol-4-yl)benzamide |
| SMILES | CNc1ccc(-c2cn[nH]c2)cc1C(N)=O |
| InChI | InChI=1S/C11H12N4O/c1-13-10-3-2-7(4-9(10)11(12)16)8-5-14-15-6-8/h2-6,13H,1H3,(H2,12,16)(H,14,15) |
| InChIKey | GINBEIGTNSFZQU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |