C46H85NO — CID 134388035
N-(cyclohexa-1,3-dien-1-ylmethyl)-2-[(8E,10E)-hexadeca-8,10-dienoxy]-3,13,15-trimethylicosan-1-amine (PubChem CID 134388035) has the molecular formula C46H85NO and a molecular weight of 668.19 g/mol. Its IUPAC name is N-(cyclohexa-1,3-dien-1-ylmethyl)-2-[(8E,10E)-hexadeca-8,10-dienoxy]-3,13,15-trimethylicosan-1-amine.
| Compound Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-2-[(8E,10E)-hexadeca-8,10-dienoxy]-3,13,15-trimethylicosan-1-amine |
|---|---|
| PubChem CID | 134388035 |
| Molecular Formula | C46H85NO |
| Molecular Weight | 668.19 g/mol |
| Exact Mass | 667.66 |
| IUPAC Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-2-[(8E,10E)-hexadeca-8,10-dienoxy]-3,13,15-trimethylicosan-1-amine |
| SMILES | CCCCC/C=C/C=C/CCCCCCCOC(CNCC1=CC=CCC1)C(C)CCCCCCCCCC(C)CC(C)CCCCC |
| InChI | InChI=1S/C46H85NO/c1-6-8-10-11-12-13-14-15-16-17-18-22-25-32-38-48-46(41-47-40-45-36-30-26-31-37-45)44(5)35-29-24-21-19-20-23-28-34-43(4)39-42(3)33-27-9-7-2/h12-15,26,30,36,42-44,46-47H,6-11,16-25,27-29,31-35,37-41H2,1-5H3/b13-12+,15-14+ |
| InChIKey | IKYVNAYTLLBEPN-SQIWNDBBSA-N |
| XLogP | 14.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.19 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|