C13H23NO — CID 134388192
1-[[(3E,5Z)-3-ethylocta-3,5,7-trienyl]-methylamino]ethanol (PubChem CID 134388192) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-[[(3E,5Z)-3-ethylocta-3,5,7-trienyl]-methylamino]ethanol.
| Compound Name | 1-[[(3E,5Z)-3-ethylocta-3,5,7-trienyl]-methylamino]ethanol |
|---|---|
| PubChem CID | 134388192 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-[[(3E,5Z)-3-ethylocta-3,5,7-trienyl]-methylamino]ethanol |
| SMILES | C=C/C=C\C=C(/CC)CCN(C)C(C)O |
| InChI | InChI=1S/C13H23NO/c1-5-7-8-9-13(6-2)10-11-14(4)12(3)15/h5,7-9,12,15H,1,6,10-11H2,2-4H3/b8-7-,13-9+ |
| InChIKey | PUKFYZYBUZVDKN-XTYDYKDCSA-N |
| XLogP | 2.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|