C12H24FN — CID 134388221
(E)-8-fluoro-N,2,4,7-tetramethyloct-6-en-1-amine (PubChem CID 134388221) has the molecular formula C12H24FN and a molecular weight of 201.33 g/mol. Its IUPAC name is (E)-8-fluoro-N,2,4,7-tetramethyloct-6-en-1-amine.
| Compound Name | (E)-8-fluoro-N,2,4,7-tetramethyloct-6-en-1-amine |
|---|---|
| PubChem CID | 134388221 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | (E)-8-fluoro-N,2,4,7-tetramethyloct-6-en-1-amine |
| SMILES | CNCC(C)CC(C)C/C=C(\C)CF |
| InChI | InChI=1S/C12H24FN/c1-10(5-6-11(2)8-13)7-12(3)9-14-4/h6,10,12,14H,5,7-9H2,1-4H3/b11-6+ |
| InChIKey | MDLGMMUAOAIEDB-IZZDOVSWSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|