C44H83NO — CID 134388259
N,3-dimethyl-4-[(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl]oxybutan-1-amine (PubChem CID 134388259) has the molecular formula C44H83NO and a molecular weight of 642.15 g/mol. Its IUPAC name is N,3-dimethyl-4-[(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl]oxybutan-1-amine.
| Compound Name | N,3-dimethyl-4-[(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl]oxybutan-1-amine |
|---|---|
| PubChem CID | 134388259 |
| Molecular Formula | C44H83NO |
| Molecular Weight | 642.15 g/mol |
| Exact Mass | 641.65 |
| IUPAC Name | N,3-dimethyl-4-[(6Z,9Z,28Z,31Z)-19-methylheptatriaconta-6,9,28,31-tetraen-19-yl]oxybutan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(C)(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(C)CCNC |
| InChI | InChI=1S/C44H83NO/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-44(4,46-42-43(3)38-41-45-5)40-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,43,45H,6-13,18-19,24-42H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | JPJWJENOTMTGIW-ZPPAUJSGSA-N |
| XLogP | 14.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.15 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|