C19H29NS — CID 134388331
(3E)-4-[2-[(4Z)-4-ethenyl-2-ethylhepta-4,6-dienyl]sulfanylethyl]hexa-1,3,5-trien-3-amine (PubChem CID 134388331) has the molecular formula C19H29NS and a molecular weight of 303.52 g/mol. Its IUPAC name is (3E)-4-[2-[(4Z)-4-ethenyl-2-ethylhepta-4,6-dienyl]sulfanylethyl]hexa-1,3,5-trien-3-amine.
| Compound Name | (3E)-4-[2-[(4Z)-4-ethenyl-2-ethylhepta-4,6-dienyl]sulfanylethyl]hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 134388331 |
| Molecular Formula | C19H29NS |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (3E)-4-[2-[(4Z)-4-ethenyl-2-ethylhepta-4,6-dienyl]sulfanylethyl]hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(\C=C)CC(CC)CSCC/C(C=C)=C(\N)C=C |
| InChI | InChI=1S/C19H29NS/c1-6-11-16(7-2)14-17(8-3)15-21-13-12-18(9-4)19(20)10-5/h6-7,9-11,17H,1-2,4-5,8,12-15,20H2,3H3/b16-11+,19-18- |
| InChIKey | PJVKZTPRYRQAMP-BDYZYUDZSA-N |
| XLogP | 5.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|