About 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol
7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol (PubChem CID 134388505) has the molecular formula C27H35BrI2S
and a molecular weight of 725.36 g/mol. Its IUPAC name is 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol.
Molecular Properties
| Compound Name | 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol |
| PubChem CID | 134388505 |
| Molecular Formula | C27H35BrI2S |
| Molecular Weight | 725.36 g/mol |
| Exact Mass | 723.97 |
| IUPAC Name | 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol |
| SMILES | CCC(CCCI)CC1(CC(CC)CCCI)c2cc(S)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C27H35BrI2S/c1-3-19(7-5-13-29)17-27(18-20(4-2)8-6-14-30)25-15-21(28)9-11-23(25)24-12-10-22(31)16-26(24)27/h9-12,15-16,19-20,31H,3-8,13-14,17-18H2,1-2H3 |
| InChIKey | JKCQBLLFILUVES-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 725.36 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol?
The IUPAC name of 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol (CID 134388505) is 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol.
What is the SMILES notation for 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol?
The canonical SMILES for 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol is CCC(CCCI)CC1(CC(CC)CCCI)c2cc(S)ccc2-c2ccc(Br)cc21.
What is the InChIKey of 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol?
The InChIKey is JKCQBLLFILUVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35BrI2S/c1-3-19(7-5-13-29)17-27(18-20(4-2)8-6-14-30)25-15-21(28)9-11-23(25)24-12-10-22(31)16-26(24)27/h9-12,15-16,19-20,31H,3-8,13-14,17-18H2,1-2H3.
What are the key properties of 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol?
7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol has a molecular weight of 725.36 g/mol, XLogP of 10.27, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-9,9-bis(2-ethyl-5-iodopentyl)fluorene-2-thiol is sourced from PubChem (CID 134388505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).