C12H26N2S2 — CID 134388698
2-[sulfanyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propane-2-thiol (PubChem CID 134388698) has the molecular formula C12H26N2S2 and a molecular weight of 262.49 g/mol. Its IUPAC name is 2-[sulfanyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propane-2-thiol.
| Compound Name | 2-[sulfanyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propane-2-thiol |
|---|---|
| PubChem CID | 134388698 |
| Molecular Formula | C12H26N2S2 |
| Molecular Weight | 262.49 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-[sulfanyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]propane-2-thiol |
| SMILES | CC1(C)CC(N(S)C(C)(C)S)CC(C)(C)N1 |
| InChI | InChI=1S/C12H26N2S2/c1-10(2)7-9(8-11(3,4)13-10)14(16)12(5,6)15/h9,13,15-16H,7-8H2,1-6H3 |
| InChIKey | SNOMIIYZEDSEDS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|