About 5-methyl-4a,5-dihydroquinolin-8-amine
5-methyl-4a,5-dihydroquinolin-8-amine (PubChem CID 134388947) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-methyl-4a,5-dihydroquinolin-8-amine.
Molecular Properties
| Compound Name | 5-methyl-4a,5-dihydroquinolin-8-amine |
| PubChem CID | 134388947 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5-methyl-4a,5-dihydroquinolin-8-amine |
| SMILES | CC1C=CC(N)=C2N=CC=CC21 |
| InChI | InChI=1S/C10H12N2/c1-7-4-5-9(11)10-8(7)3-2-6-12-10/h2-8H,11H2,1H3 |
| InChIKey | HPALZMJAGNPWEB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4a,5-dihydroquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4a,5-dihydroquinolin-8-amine?
The IUPAC name of 5-methyl-4a,5-dihydroquinolin-8-amine (CID 134388947) is 5-methyl-4a,5-dihydroquinolin-8-amine.
What is the SMILES notation for 5-methyl-4a,5-dihydroquinolin-8-amine?
The canonical SMILES for 5-methyl-4a,5-dihydroquinolin-8-amine is CC1C=CC(N)=C2N=CC=CC21.
What is the InChIKey of 5-methyl-4a,5-dihydroquinolin-8-amine?
The InChIKey is HPALZMJAGNPWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-4-5-9(11)10-8(7)3-2-6-12-10/h2-8H,11H2,1H3.
What are the key properties of 5-methyl-4a,5-dihydroquinolin-8-amine?
5-methyl-4a,5-dihydroquinolin-8-amine has a molecular weight of 160.22 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4a,5-dihydroquinolin-8-amine is sourced from PubChem (CID 134388947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).