C40H33N3O — CID 134389425
4-[4-[7-(1,2-dihydropyridin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-8-methyl-16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,10,12,14-hexaene (PubChem CID 134389425) has the molecular formula C40H33N3O and a molecular weight of 571.72 g/mol. Its IUPAC name is 4-[4-[7-(1,2-dihydropyridin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-8-methyl-16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,10,12,14-hexaene.
| Compound Name | 4-[4-[7-(1,2-dihydropyridin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-8-methyl-16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,10,12,14-hexaene |
|---|---|
| PubChem CID | 134389425 |
| Molecular Formula | C40H33N3O |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 4-[4-[7-(1,2-dihydropyridin-4-yl)-9,9-dimethylfluoren-2-yl]phenyl]-8-methyl-16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,10,12,14-hexaene |
| SMILES | CN1c2c(oc3ccccc23)N2C=C(c3ccc(-c4ccc5c(c4)C(C)(C)c4cc(C6=CCNC=C6)ccc4-5)cc3)C=CC12 |
| InChI | InChI=1S/C40H33N3O/c1-40(2)34-22-28(12-15-31(34)32-16-13-29(23-35(32)40)27-18-20-41-21-19-27)25-8-10-26(11-9-25)30-14-17-37-42(3)38-33-6-4-5-7-36(33)44-39(38)43(37)24-30/h4-20,22-24,37,41H,21H2,1-3H3 |
| InChIKey | WFZPYLNRVLLBMU-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|