C15H19FO — CID 134389449
1-fluoro-3-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]cyclohexa-1,3-diene (PubChem CID 134389449) has the molecular formula C15H19FO and a molecular weight of 234.31 g/mol. Its IUPAC name is 1-fluoro-3-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]cyclohexa-1,3-diene.
| Compound Name | 1-fluoro-3-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134389449 |
| Molecular Formula | C15H19FO |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-fluoro-3-[[(3E,5Z)-octa-1,3,5-trien-4-yl]oxymethyl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C(\C=C/CC)OCC1=CCCC(F)=C1 |
| InChI | InChI=1S/C15H19FO/c1-3-5-10-15(7-4-2)17-12-13-8-6-9-14(16)11-13/h4-5,7-8,10-11H,2-3,6,9,12H2,1H3/b10-5-,15-7+ |
| InChIKey | GHQNICTZNUSGDQ-CKQVJBQMSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|