About 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol
4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol (PubChem CID 134389473) has the molecular formula C31H23F2NO2
and a molecular weight of 479.53 g/mol. Its IUPAC name is 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol.
Molecular Properties
| Compound Name | 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol |
| PubChem CID | 134389473 |
| Molecular Formula | C31H23F2NO2 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol |
| SMILES | Oc1ccc(-c2cc(CCc3ccc(-c4ccc(F)cc4F)nc3)cc(-c3ccc(O)cc3)c2)cc1 |
| InChI | InChI=1S/C31H23F2NO2/c32-26-8-13-29(30(33)18-26)31-14-3-20(19-34-31)1-2-21-15-24(22-4-9-27(35)10-5-22)17-25(16-21)23-6-11-28(36)12-7-23/h3-19,35-36H,1-2H2 |
| InChIKey | RVJSIUAFAFFLEA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol?
The IUPAC name of 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol (CID 134389473) is 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol.
What is the SMILES notation for 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol?
The canonical SMILES for 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol is Oc1ccc(-c2cc(CCc3ccc(-c4ccc(F)cc4F)nc3)cc(-c3ccc(O)cc3)c2)cc1.
What is the InChIKey of 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol?
The InChIKey is RVJSIUAFAFFLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H23F2NO2/c32-26-8-13-29(30(33)18-26)31-14-3-20(19-34-31)1-2-21-15-24(22-4-9-27(35)10-5-22)17-25(16-21)23-6-11-28(36)12-7-23/h3-19,35-36H,1-2H2.
What are the key properties of 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol?
4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol has a molecular weight of 479.53 g/mol, XLogP of 7.56, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4-hydroxyphenyl)phenyl]phenol is sourced from PubChem (CID 134389473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).