About 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal
2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal (PubChem CID 134389495) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal.
Molecular Properties
| Compound Name | 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal |
| PubChem CID | 134389495 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal |
| SMILES | C=C(C)/C(C)=C/N=C(\C)C=O |
| InChI | InChI=1S/C9H13NO/c1-7(2)8(3)5-10-9(4)6-11/h5-6H,1H2,2-4H3/b8-5+,10-9+ |
| InChIKey | SMIYWWMVFKFASK-CPSCNVPRSA-N |
| XLogP | 2.13 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal?
The IUPAC name of 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal (CID 134389495) is 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal.
What is the SMILES notation for 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal?
The canonical SMILES for 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal is C=C(C)/C(C)=C/N=C(\C)C=O.
What is the InChIKey of 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal?
The InChIKey is SMIYWWMVFKFASK-CPSCNVPRSA-N. The full InChI is InChI=1S/C9H13NO/c1-7(2)8(3)5-10-9(4)6-11/h5-6H,1H2,2-4H3/b8-5+,10-9+.
What are the key properties of 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal?
2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal has a molecular weight of 151.21 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-2,3-dimethylbuta-1,3-dienyl]iminopropanal is sourced from PubChem (CID 134389495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).