About 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine
5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine (PubChem CID 134389528) has the molecular formula C14H12F3N
and a molecular weight of 251.25 g/mol. Its IUPAC name is 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine.
Molecular Properties
| Compound Name | 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine |
| PubChem CID | 134389528 |
| Molecular Formula | C14H12F3N |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine |
| SMILES | Cc1ccc(C2=CCC=CC(C(F)(F)F)=C2)nc1 |
| InChI | InChI=1S/C14H12F3N/c1-10-6-7-13(18-9-10)11-4-2-3-5-12(8-11)14(15,16)17/h3-9H,2H2,1H3 |
| InChIKey | DKLNFFBZGWBFJW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine?
The IUPAC name of 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine (CID 134389528) is 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine.
What is the SMILES notation for 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine?
The canonical SMILES for 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine is Cc1ccc(C2=CCC=CC(C(F)(F)F)=C2)nc1.
What is the InChIKey of 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine?
The InChIKey is DKLNFFBZGWBFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N/c1-10-6-7-13(18-9-10)11-4-2-3-5-12(8-11)14(15,16)17/h3-9H,2H2,1H3.
What are the key properties of 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine?
5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine has a molecular weight of 251.25 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]pyridine is sourced from PubChem (CID 134389528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).