C24H47NO — CID 134389538
2-(butan-2-ylamino)-1-[(1Z)-cyclononen-1-yl]-4,5-dimethylnonan-3-ol (PubChem CID 134389538) has the molecular formula C24H47NO and a molecular weight of 365.65 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-1-[(1Z)-cyclononen-1-yl]-4,5-dimethylnonan-3-ol.
| Compound Name | 2-(butan-2-ylamino)-1-[(1Z)-cyclononen-1-yl]-4,5-dimethylnonan-3-ol |
|---|---|
| PubChem CID | 134389538 |
| Molecular Formula | C24H47NO |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.37 |
| IUPAC Name | 2-(butan-2-ylamino)-1-[(1Z)-cyclononen-1-yl]-4,5-dimethylnonan-3-ol |
| SMILES | CCCCC(C)C(C)C(O)C(C/C1=C\CCCCCCC1)NC(C)CC |
| InChI | InChI=1S/C24H47NO/c1-6-8-15-19(3)21(5)24(26)23(25-20(4)7-2)18-22-16-13-11-9-10-12-14-17-22/h16,19-21,23-26H,6-15,17-18H2,1-5H3/b22-16- |
| InChIKey | TZTCBANZDUXRDD-JWGURIENSA-N |
| XLogP | 6.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|