About 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol
1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol (PubChem CID 134389561) has the molecular formula C15H22N2O3S2
and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol.
Molecular Properties
| Compound Name | 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol |
| PubChem CID | 134389561 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(S(=O)(=O)N2CCC3(CC2)NCCS3)cc1 |
| InChI | InChI=1S/C15H22N2O3S2/c1-12(18)13-2-4-14(5-3-13)22(19,20)17-9-6-15(7-10-17)16-8-11-21-15/h2-5,12,16,18H,6-11H2,1H3 |
| InChIKey | GJMJQAQWKKVQKZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol?
The IUPAC name of 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol (CID 134389561) is 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol.
What is the SMILES notation for 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol?
The canonical SMILES for 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol is CC(O)c1ccc(S(=O)(=O)N2CCC3(CC2)NCCS3)cc1.
What is the InChIKey of 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol?
The InChIKey is GJMJQAQWKKVQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3S2/c1-12(18)13-2-4-14(5-3-13)22(19,20)17-9-6-15(7-10-17)16-8-11-21-15/h2-5,12,16,18H,6-11H2,1H3.
What are the key properties of 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol?
1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol has a molecular weight of 342.49 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-thia-4,8-diazaspiro[4.5]decan-8-ylsulfonyl)phenyl]ethanol is sourced from PubChem (CID 134389561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).