About 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine
4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine (PubChem CID 134389572) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine.
Molecular Properties
| Compound Name | 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine |
| PubChem CID | 134389572 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine |
| SMILES | C=C(C)CCNC1(NC)CCNCC1 |
| InChI | InChI=1S/C11H23N3/c1-10(2)4-7-14-11(12-3)5-8-13-9-6-11/h12-14H,1,4-9H2,2-3H3 |
| InChIKey | QQSSIOUFJAIJKB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine?
The IUPAC name of 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine (CID 134389572) is 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine.
What is the SMILES notation for 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine?
The canonical SMILES for 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine is C=C(C)CCNC1(NC)CCNCC1.
What is the InChIKey of 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine?
The InChIKey is QQSSIOUFJAIJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-10(2)4-7-14-11(12-3)5-8-13-9-6-11/h12-14H,1,4-9H2,2-3H3.
What are the key properties of 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine?
4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine has a molecular weight of 197.33 g/mol, XLogP of 0.84, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-4-N'-(3-methylbut-3-enyl)piperidine-4,4-diamine is sourced from PubChem (CID 134389572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).