About (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine
(5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine (PubChem CID 134389733) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine.
Molecular Properties
| Compound Name | (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine |
| PubChem CID | 134389733 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine |
| SMILES | C=C(/C=C(\C=C(C)C)SC)CCCN |
| InChI | InChI=1S/C12H21NS/c1-10(2)8-12(14-4)9-11(3)6-5-7-13/h8-9H,3,5-7,13H2,1-2,4H3/b12-9+ |
| InChIKey | BQMBSJOECLOQAW-FMIVXFBMSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine?
The IUPAC name of (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine (CID 134389733) is (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine.
What is the SMILES notation for (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine?
The canonical SMILES for (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine is C=C(/C=C(\C=C(C)C)SC)CCCN.
What is the InChIKey of (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine?
The InChIKey is BQMBSJOECLOQAW-FMIVXFBMSA-N. The full InChI is InChI=1S/C12H21NS/c1-10(2)8-12(14-4)9-11(3)6-5-7-13/h8-9H,3,5-7,13H2,1-2,4H3/b12-9+.
What are the key properties of (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine?
(5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine has a molecular weight of 211.37 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-8-methyl-4-methylidene-6-methylsulfanylnona-5,7-dien-1-amine is sourced from PubChem (CID 134389733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).