C15H23F3S — CID 134389736
(3E,5E)-2,3,6-trimethyl-4-(trifluoromethylsulfanyl)undeca-1,3,5-triene (PubChem CID 134389736) has the molecular formula C15H23F3S and a molecular weight of 292.41 g/mol. Its IUPAC name is (3E,5E)-2,3,6-trimethyl-4-(trifluoromethylsulfanyl)undeca-1,3,5-triene.
| Compound Name | (3E,5E)-2,3,6-trimethyl-4-(trifluoromethylsulfanyl)undeca-1,3,5-triene |
|---|---|
| PubChem CID | 134389736 |
| Molecular Formula | C15H23F3S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (3E,5E)-2,3,6-trimethyl-4-(trifluoromethylsulfanyl)undeca-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C(\C=C(/C)CCCCC)SC(F)(F)F |
| InChI | InChI=1S/C15H23F3S/c1-6-7-8-9-12(4)10-14(13(5)11(2)3)19-15(16,17)18/h10H,2,6-9H2,1,3-5H3/b12-10+,14-13+ |
| InChIKey | NAHHEXPUUIJMAK-HBKPYOMSSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|