C16H19N3O — CID 134389861
3-[(1E,3Z,5Z)-4-ethylhepta-1,3,5-trienyl]-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 134389861) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[(1E,3Z,5Z)-4-ethylhepta-1,3,5-trienyl]-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[(1E,3Z,5Z)-4-ethylhepta-1,3,5-trienyl]-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 134389861 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[(1E,3Z,5Z)-4-ethylhepta-1,3,5-trienyl]-6-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | C/C=C\C(=C/C=C/n1cc2cc(C)[nH]c2nc1=O)CC |
| InChI | InChI=1S/C16H19N3O/c1-4-7-13(5-2)8-6-9-19-11-14-10-12(3)17-15(14)18-16(19)20/h4,6-11H,5H2,1-3H3,(H,17,18,20)/b7-4-,9-6+,13-8- |
| InChIKey | AXHQELJNCBPUNR-FATHVWFQSA-N |
| XLogP | 3.42 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|