C19H27N7O — CID 134389867
2-[3-[[(2E,4E)-2-ethenyl-5-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)hexa-2,4-dienyl]amino]propyl]guanidine (PubChem CID 134389867) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[3-[[(2E,4E)-2-ethenyl-5-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)hexa-2,4-dienyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(2E,4E)-2-ethenyl-5-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)hexa-2,4-dienyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 134389867 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[3-[[(2E,4E)-2-ethenyl-5-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)hexa-2,4-dienyl]amino]propyl]guanidine |
| SMILES | C=C/C(=C\C=C(/C)n1cc2cc(C)[nH]c2nc1=O)CNCCCN=C(N)N |
| InChI | InChI=1S/C19H27N7O/c1-4-15(11-22-8-5-9-23-18(20)21)7-6-14(3)26-12-16-10-13(2)24-17(16)25-19(26)27/h4,6-7,10,12,22H,1,5,8-9,11H2,2-3H3,(H4,20,21,23)(H,24,25,27)/b14-6+,15-7+ |
| InChIKey | UIGHGQHLCWZEPM-MKFXEVHTSA-N |
| XLogP | 1.26 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|