C20H25NS — CID 134389949
[4-[(2E,4Z)-hepta-2,4-dien-2-yl]-1,2,5a,9a-tetrahydrodibenzothiophen-3-yl]methanamine (PubChem CID 134389949) has the molecular formula C20H25NS and a molecular weight of 311.49 g/mol. Its IUPAC name is [4-[(2E,4Z)-hepta-2,4-dien-2-yl]-1,2,5a,9a-tetrahydrodibenzothiophen-3-yl]methanamine.
| Compound Name | [4-[(2E,4Z)-hepta-2,4-dien-2-yl]-1,2,5a,9a-tetrahydrodibenzothiophen-3-yl]methanamine |
|---|---|
| PubChem CID | 134389949 |
| Molecular Formula | C20H25NS |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | [4-[(2E,4Z)-hepta-2,4-dien-2-yl]-1,2,5a,9a-tetrahydrodibenzothiophen-3-yl]methanamine |
| SMILES | CC/C=C\C=C(/C)C1=C(CN)CCC2=C1SC1C=CC=CC21 |
| InChI | InChI=1S/C20H25NS/c1-3-4-5-8-14(2)19-15(13-21)11-12-17-16-9-6-7-10-18(16)22-20(17)19/h4-10,16,18H,3,11-13,21H2,1-2H3/b5-4-,14-8+ |
| InChIKey | YKDAOHOUTFKLML-HNQGTOQISA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|