C13H13F2NO3 — CID 134390221
5-[[(2Z,4E)-5-fluoro-2-(1-fluoroethenyl)hexa-2,4-dienoxy]methyl]-1,2-oxazole-3-carbaldehyde (PubChem CID 134390221) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is 5-[[(2Z,4E)-5-fluoro-2-(1-fluoroethenyl)hexa-2,4-dienoxy]methyl]-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-[[(2Z,4E)-5-fluoro-2-(1-fluoroethenyl)hexa-2,4-dienoxy]methyl]-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 134390221 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-[[(2Z,4E)-5-fluoro-2-(1-fluoroethenyl)hexa-2,4-dienoxy]methyl]-1,2-oxazole-3-carbaldehyde |
| SMILES | C=C(F)/C(=C\C=C(/C)F)COCc1cc(C=O)no1 |
| InChI | InChI=1S/C13H13F2NO3/c1-9(14)3-4-11(10(2)15)7-18-8-13-5-12(6-17)16-19-13/h3-6H,2,7-8H2,1H3/b9-3+,11-4- |
| InChIKey | SNMQSKAFIAHHHK-USKHSNOHSA-N |
| XLogP | 3.29 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|