C47H36N4O — CID 134390345
2-cyclohex-3-en-1-yl-6-[3-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole (PubChem CID 134390345) has the molecular formula C47H36N4O and a molecular weight of 672.83 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-6-[3-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole.
| Compound Name | 2-cyclohex-3-en-1-yl-6-[3-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole |
|---|---|
| PubChem CID | 134390345 |
| Molecular Formula | C47H36N4O |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-6-[3-[4-phenyl-6-(4-phenylphenyl)pyrimidin-2-yl]phenyl]-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole |
| SMILES | C1=CCC(C2Nc3ccc4c(c3O2)c2ccccc2n4-c2cccc(-c3nc(-c4ccccc4)cc(-c4ccc(-c5ccccc5)cc4)n3)c2)CC1 |
| InChI | InChI=1S/C47H36N4O/c1-4-13-31(14-5-1)32-23-25-34(26-24-32)41-30-40(33-15-6-2-7-16-33)48-46(49-41)36-19-12-20-37(29-36)51-42-22-11-10-21-38(42)44-43(51)28-27-39-45(44)52-47(50-39)35-17-8-3-9-18-35/h1-8,10-16,19-30,35,47,50H,9,17-18H2 |
| InChIKey | IFJMKYWRCRIMNA-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|