C48H54N2 — CID 134390361
1-[9-(3-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-yl)-4a,4b,7,8,8a,9a-hexahydrocarbazol-3-yl]-9-(4-cyclohex-2-en-1-ylcyclohex-3-en-1-yl)-4a,4b,8a,9a-tetrahydrocarbazole (PubChem CID 134390361) has the molecular formula C48H54N2 and a molecular weight of 658.97 g/mol. Its IUPAC name is 1-[9-(3-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-yl)-4a,4b,7,8,8a,9a-hexahydrocarbazol-3-yl]-9-(4-cyclohex-2-en-1-ylcyclohex-3-en-1-yl)-4a,4b,8a,9a-tetrahydrocarbazole.
| Compound Name | 1-[9-(3-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-yl)-4a,4b,7,8,8a,9a-hexahydrocarbazol-3-yl]-9-(4-cyclohex-2-en-1-ylcyclohex-3-en-1-yl)-4a,4b,8a,9a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 134390361 |
| Molecular Formula | C48H54N2 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | 1-[9-(3-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-yl)-4a,4b,7,8,8a,9a-hexahydrocarbazol-3-yl]-9-(4-cyclohex-2-en-1-ylcyclohex-3-en-1-yl)-4a,4b,8a,9a-tetrahydrocarbazole |
| SMILES | C1=CCCC(C2=CC(N3C4C=CC(C5=CC=CC6C7C=CC=CC7N(C7CC=C(C8C=CCCC8)CC7)C56)=CC4C4C=CCCC43)CC=C2)=C1 |
| InChI | InChI=1S/C48H54N2/c1-3-13-33(14-4-1)35-25-28-38(29-26-35)50-46-24-10-7-19-41(46)43-22-12-21-40(48(43)50)37-27-30-47-44(32-37)42-20-8-9-23-45(42)49(47)39-18-11-17-36(31-39)34-15-5-2-6-16-34/h2-3,5,7-8,10-13,15,17,19-22,24-25,27,30-33,38-39,41-48H,1,4,6,9,14,16,18,23,26,28-29H2 |
| InChIKey | BJHLZWNPMLRKDX-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|