C42H45N — CID 134390537
2-(4a,4b,8a,9,10,12b-hexahydrotriphenylen-2-yl)-9-(5-cyclohex-3-en-1-ylcyclohexa-2,4-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole (PubChem CID 134390537) has the molecular formula C42H45N and a molecular weight of 563.83 g/mol. Its IUPAC name is 2-(4a,4b,8a,9,10,12b-hexahydrotriphenylen-2-yl)-9-(5-cyclohex-3-en-1-ylcyclohexa-2,4-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole.
| Compound Name | 2-(4a,4b,8a,9,10,12b-hexahydrotriphenylen-2-yl)-9-(5-cyclohex-3-en-1-ylcyclohexa-2,4-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole |
|---|---|
| PubChem CID | 134390537 |
| Molecular Formula | C42H45N |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | 2-(4a,4b,8a,9,10,12b-hexahydrotriphenylen-2-yl)-9-(5-cyclohex-3-en-1-ylcyclohexa-2,4-dien-1-yl)-1,2,4a,4b,8a,9a-hexahydrocarbazole |
| SMILES | C1=CC2C3=C(C=CCC3)C3C=C(C4C=CC5C6C=CC=CC6N(C6C=CC=C(C7CC=CCC7)C6)C5C4)C=CC3C2C=C1 |
| InChI | InChI=1S/C42H45N/c1-2-11-28(12-3-1)29-13-10-14-32(25-29)43-41-20-9-8-19-38(41)39-24-22-31(27-42(39)43)30-21-23-37-35-17-5-4-15-33(35)34-16-6-7-18-36(34)40(37)26-30/h1-2,4-5,7-10,13-15,17-24,26,28,31-33,35,37-42H,3,6,11-12,16,25,27H2 |
| InChIKey | MZLPQVOMZGPDIC-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|