C11H14N2O — CID 13439066
6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboximidamide (PubChem CID 13439066) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboximidamide.
| Compound Name | 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 13439066 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C11H14N2O/c12-11(13)9-2-1-8-6-10(14)4-3-7(8)5-9/h3-4,6,9,14H,1-2,5H2,(H3,12,13) |
| InChIKey | UIOUVOKRQUZRAL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|