About 9,11-dihydrocyclohepta[b][1,4]benzoxazine
9,11-dihydrocyclohepta[b][1,4]benzoxazine (PubChem CID 134390853) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 9,11-dihydrocyclohepta[b][1,4]benzoxazine.
Molecular Properties
| Compound Name | 9,11-dihydrocyclohepta[b][1,4]benzoxazine |
| PubChem CID | 134390853 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 9,11-dihydrocyclohepta[b][1,4]benzoxazine |
| SMILES | C1=CCC=C2Nc3ccccc3OC2=C1 |
| InChI | InChI=1S/C13H11NO/c1-2-6-10-12(8-3-1)15-13-9-5-4-7-11(13)14-10/h1,3-9,14H,2H2 |
| InChIKey | NJTGWZCLODSYFB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,11-dihydrocyclohepta[b][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,11-dihydrocyclohepta[b][1,4]benzoxazine?
The IUPAC name of 9,11-dihydrocyclohepta[b][1,4]benzoxazine (CID 134390853) is 9,11-dihydrocyclohepta[b][1,4]benzoxazine.
What is the SMILES notation for 9,11-dihydrocyclohepta[b][1,4]benzoxazine?
The canonical SMILES for 9,11-dihydrocyclohepta[b][1,4]benzoxazine is C1=CCC=C2Nc3ccccc3OC2=C1.
What is the InChIKey of 9,11-dihydrocyclohepta[b][1,4]benzoxazine?
The InChIKey is NJTGWZCLODSYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-2-6-10-12(8-3-1)15-13-9-5-4-7-11(13)14-10/h1,3-9,14H,2H2.
What are the key properties of 9,11-dihydrocyclohepta[b][1,4]benzoxazine?
9,11-dihydrocyclohepta[b][1,4]benzoxazine has a molecular weight of 197.24 g/mol, XLogP of 3.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,11-dihydrocyclohepta[b][1,4]benzoxazine is sourced from PubChem (CID 134390853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).