C31H22N2O3 — CID 134390993
2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(2-phenylethynyl)quinolin-6-yl]acetic acid (PubChem CID 134390993) has the molecular formula C31H22N2O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(2-phenylethynyl)quinolin-6-yl]acetic acid.
| Compound Name | 2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(2-phenylethynyl)quinolin-6-yl]acetic acid |
|---|---|
| PubChem CID | 134390993 |
| Molecular Formula | C31H22N2O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)-2-(2-phenylethynyl)quinolin-6-yl]acetic acid |
| SMILES | Cc1cc2nc(C#Cc3ccccc3)ccc2c(-c2ccc3c4c(ccnc24)CCO3)c1CC(=O)O |
| InChI | InChI=1S/C31H22N2O3/c1-19-17-26-23(10-9-22(33-26)8-7-20-5-3-2-4-6-20)30(25(19)18-28(34)35)24-11-12-27-29-21(14-16-36-27)13-15-32-31(24)29/h2-6,9-13,15,17H,14,16,18H2,1H3,(H,34,35) |
| InChIKey | JFAVNUMBFRYWBO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|