C21H36N2 — CID 134391114
3-N-(1-cyclohexa-1,5-dien-1-ylpropyl)-2-N-octan-3-ylbuta-1,3-diene-2,3-diamine (PubChem CID 134391114) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is 3-N-(1-cyclohexa-1,5-dien-1-ylpropyl)-2-N-octan-3-ylbuta-1,3-diene-2,3-diamine.
| Compound Name | 3-N-(1-cyclohexa-1,5-dien-1-ylpropyl)-2-N-octan-3-ylbuta-1,3-diene-2,3-diamine |
|---|---|
| PubChem CID | 134391114 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | 3-N-(1-cyclohexa-1,5-dien-1-ylpropyl)-2-N-octan-3-ylbuta-1,3-diene-2,3-diamine |
| SMILES | C=C(NC(CC)CCCCC)C(=C)NC(CC)C1=CCCC=C1 |
| InChI | InChI=1S/C21H36N2/c1-6-9-11-16-20(7-2)22-17(4)18(5)23-21(8-3)19-14-12-10-13-15-19/h12,14-15,20-23H,4-11,13,16H2,1-3H3 |
| InChIKey | AWIWZZAZKXMKGA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|