C62H58N4S5 — CID 134391331
4,7-bis[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 134391331) has the molecular formula C62H58N4S5 and a molecular weight of 1019.51 g/mol. Its IUPAC name is 4,7-bis[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 134391331 |
| Molecular Formula | C62H58N4S5 |
| Molecular Weight | 1019.51 g/mol |
| Exact Mass | 1018.33 |
| IUPAC Name | 4,7-bis[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCn1c2ccccc2c2cc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccc(-c8ccc9c(c8)c8ccccc8n9CCCCCCCC)s7)s6)c6nsnc56)s4)s3)ccc21 |
| InChI | InChI=1S/C62H58N4S5/c1-3-5-7-9-11-17-37-65-49-21-15-13-19-43(49)47-39-41(23-27-51(47)65)53-29-33-57(67-53)59-35-31-55(69-59)45-25-26-46(62-61(45)63-71-64-62)56-32-36-60(70-56)58-34-30-54(68-58)42-24-28-52-48(40-42)44-20-14-16-22-50(44)66(52)38-18-12-10-8-6-4-2/h13-16,19-36,39-40H,3-12,17-18,37-38H2,1-2H3 |
| InChIKey | ITNPNBIHULEFMR-UHFFFAOYSA-N |
| XLogP | 20.88 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.51 |
| LogP ≤ 5 | 20.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|