C33H30N2O4S — CID 134391383
2-[5-(1,3-benzothiazol-2-yl)-10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-6-yl]benzoic acid (PubChem CID 134391383) has the molecular formula C33H30N2O4S and a molecular weight of 550.68 g/mol. Its IUPAC name is 2-[5-(1,3-benzothiazol-2-yl)-10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-6-yl]benzoic acid.
| Compound Name | 2-[5-(1,3-benzothiazol-2-yl)-10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-6-yl]benzoic acid |
|---|---|
| PubChem CID | 134391383 |
| Molecular Formula | C33H30N2O4S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-[5-(1,3-benzothiazol-2-yl)-10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-6-yl]benzoic acid |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c2c1cc1c(-c2ccccc2C(=O)O)c(-c2nc4ccccc4s2)c(=O)oc31 |
| InChI | InChI=1S/C33H30N2O4S/c1-32(2)13-15-35-16-14-33(3,4)26-27(35)21(32)17-20-24(18-9-5-6-10-19(18)30(36)37)25(31(38)39-28(20)26)29-34-22-11-7-8-12-23(22)40-29/h5-12,17H,13-16H2,1-4H3,(H,36,37) |
| InChIKey | HWAQFDNITUBELE-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|