C28H22N2O4S — CID 134391384
2-[3-(1,3-benzothiazol-2-yl)-9-ethyl-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-4-yl]benzoic acid (PubChem CID 134391384) has the molecular formula C28H22N2O4S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)-9-ethyl-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-4-yl]benzoic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)-9-ethyl-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 134391384 |
| Molecular Formula | C28H22N2O4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)-9-ethyl-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-4-yl]benzoic acid |
| SMILES | CCN1CCCc2cc3c(-c4ccccc4C(=O)O)c(-c4nc5ccccc5s4)c(=O)oc3cc21 |
| InChI | InChI=1S/C28H22N2O4S/c1-2-30-13-7-8-16-14-19-22(15-21(16)30)34-28(33)25(26-29-20-11-5-6-12-23(20)35-26)24(19)17-9-3-4-10-18(17)27(31)32/h3-6,9-12,14-15H,2,7-8,13H2,1H3,(H,31,32) |
| InChIKey | FGJPNTAWVWZRCB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|