C29H22N2O4S — CID 134391387
2-[5-(1,3-benzothiazol-2-yl)-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl]benzoic acid (PubChem CID 134391387) has the molecular formula C29H22N2O4S and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[5-(1,3-benzothiazol-2-yl)-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl]benzoic acid.
| Compound Name | 2-[5-(1,3-benzothiazol-2-yl)-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl]benzoic acid |
|---|---|
| PubChem CID | 134391387 |
| Molecular Formula | C29H22N2O4S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 2-[5-(1,3-benzothiazol-2-yl)-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-6-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c(-c2nc3ccccc3s2)c(=O)oc2c3c4c(cc12)CCCN4CCC3 |
| InChI | InChI=1S/C29H22N2O4S/c32-28(33)18-9-2-1-8-17(18)23-20-15-16-7-5-13-31-14-6-10-19(25(16)31)26(20)35-29(34)24(23)27-30-21-11-3-4-12-22(21)36-27/h1-4,8-9,11-12,15H,5-7,10,13-14H2,(H,32,33) |
| InChIKey | KUWSOGUVXDPZJF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|