About tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate
tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate (PubChem CID 134391885) has the molecular formula C18H22O5S
and a molecular weight of 350.44 g/mol. Its IUPAC name is tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate.
Molecular Properties
| Compound Name | tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate |
| PubChem CID | 134391885 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate |
| SMILES | COc1cc2cc(C(=O)CCC(=O)OC(C)(C)C)sc2cc1OC |
| InChI | InChI=1S/C18H22O5S/c1-18(2,3)23-17(20)7-6-12(19)16-9-11-8-13(21-4)14(22-5)10-15(11)24-16/h8-10H,6-7H2,1-5H3 |
| InChIKey | SOMAXGSQHFGSLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate?
The IUPAC name of tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate (CID 134391885) is tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate.
What is the SMILES notation for tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate?
The canonical SMILES for tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate is COc1cc2cc(C(=O)CCC(=O)OC(C)(C)C)sc2cc1OC.
What is the InChIKey of tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate?
The InChIKey is SOMAXGSQHFGSLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O5S/c1-18(2,3)23-17(20)7-6-12(19)16-9-11-8-13(21-4)14(22-5)10-15(11)24-16/h8-10H,6-7H2,1-5H3.
What are the key properties of tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate?
tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate has a molecular weight of 350.44 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate is sourced from PubChem (CID 134391885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).