C55H44N4S5 — CID 134392063
7-[5-[5-(9-methylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-4-[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 134392063) has the molecular formula C55H44N4S5 and a molecular weight of 921.32 g/mol. Its IUPAC name is 7-[5-[5-(9-methylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-4-[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 7-[5-[5-(9-methylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-4-[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 134392063 |
| Molecular Formula | C55H44N4S5 |
| Molecular Weight | 921.32 g/mol |
| Exact Mass | 920.22 |
| IUPAC Name | 7-[5-[5-(9-methylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-4-[5-[5-(9-octylcarbazol-3-yl)thiophen-2-yl]thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCn1c2ccccc2c2cc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(-c7ccc(-c8ccc9c(c8)c8ccccc8n9C)s7)s6)c6nsnc56)s4)s3)ccc21 |
| InChI | InChI=1S/C55H44N4S5/c1-3-4-5-6-7-12-31-59-44-16-11-9-14-37(44)41-33-35(18-22-45(41)59)47-24-28-51(61-47)53-30-26-49(63-53)39-20-19-38(54-55(39)57-64-56-54)48-25-29-52(62-48)50-27-23-46(60-50)34-17-21-43-40(32-34)36-13-8-10-15-42(36)58(43)2/h8-11,13-30,32-33H,3-7,12,31H2,1-2H3 |
| InChIKey | ODJWFDHCUTXQOQ-UHFFFAOYSA-N |
| XLogP | 18.05 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.32 |
| LogP ≤ 5 | 18.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|