C14H19F2N5O2 — CID 134392814
N'-[N'-(3,4-dimethoxyphenyl)carbamimidoyl]-3,3-difluoropyrrolidine-1-carboximidamide (PubChem CID 134392814) has the molecular formula C14H19F2N5O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is N'-[N'-(3,4-dimethoxyphenyl)carbamimidoyl]-3,3-difluoropyrrolidine-1-carboximidamide.
| Compound Name | N'-[N'-(3,4-dimethoxyphenyl)carbamimidoyl]-3,3-difluoropyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 134392814 |
| Molecular Formula | C14H19F2N5O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N'-[N'-(3,4-dimethoxyphenyl)carbamimidoyl]-3,3-difluoropyrrolidine-1-carboximidamide |
| SMILES | COc1ccc(/N=C(N)/N=C(\N)N2CCC(F)(F)C2)cc1OC |
| InChI | InChI=1S/C14H19F2N5O2/c1-22-10-4-3-9(7-11(10)23-2)19-12(17)20-13(18)21-6-5-14(15,16)8-21/h3-4,7H,5-6,8H2,1-2H3,(H4,17,18,19,20) |
| InChIKey | QGRUOTFCMFSNCP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|