C19H19N7S — CID 134392849
N-(1H-indazol-5-yl)-5-(3-piperazin-1-ylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 134392849) has the molecular formula C19H19N7S and a molecular weight of 377.48 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-5-(3-piperazin-1-ylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1H-indazol-5-yl)-5-(3-piperazin-1-ylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 134392849 |
| Molecular Formula | C19H19N7S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(1H-indazol-5-yl)-5-(3-piperazin-1-ylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1cc(-c2nnc(Nc3ccc4[nH]ncc4c3)s2)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C19H19N7S/c1-2-13(11-16(3-1)26-8-6-20-7-9-26)18-24-25-19(27-18)22-15-4-5-17-14(10-15)12-21-23-17/h1-5,10-12,20H,6-9H2,(H,21,23)(H,22,25) |
| InChIKey | LNKUQRDLPKAFNI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |