C22H25F3N4O3 — CID 134393450
(5S)-3,3,5-trimethyl-12-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-7-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one (PubChem CID 134393450) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is (5S)-3,3,5-trimethyl-12-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-7-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one.
| Compound Name | (5S)-3,3,5-trimethyl-12-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-7-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one |
|---|---|
| PubChem CID | 134393450 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (5S)-3,3,5-trimethyl-12-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-7-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-one |
| SMILES | C[C@H]1CC(C)(C)N2c3nc(-n4ccc(OCCC5(C(F)(F)F)CC5)n4)ccc3C(=O)OC12 |
| InChI | InChI=1S/C22H25F3N4O3/c1-13-12-20(2,3)29-17-14(19(30)32-18(13)29)4-5-15(26-17)28-10-6-16(27-28)31-11-9-21(7-8-21)22(23,24)25/h4-6,10,13,18H,7-9,11-12H2,1-3H3/t13-,18?/m0/s1 |
| InChIKey | BHKIXXMUVIDDSH-FVRDMJKUSA-N |
| XLogP | 4.50 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |